C11H15BrN2 — CID 84635598
5-bromo-2,4,7-trimethyl-2,3-dihydro-1H-quinoxaline (PubChem CID 84635598) has the molecular formula C11H15BrN2 and a molecular weight of 255.16 g/mol. Its IUPAC name is 5-bromo-2,4,7-trimethyl-2,3-dihydro-1H-quinoxaline.
| Compound Name | 5-bromo-2,4,7-trimethyl-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 84635598 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-bromo-2,4,7-trimethyl-2,3-dihydro-1H-quinoxaline |
| SMILES | Cc1cc(Br)c2c(c1)NC(C)CN2C |
| InChI | InChI=1S/C11H15BrN2/c1-7-4-9(12)11-10(5-7)13-8(2)6-14(11)3/h4-5,8,13H,6H2,1-3H3 |
| InChIKey | PJQRKSZZSUNTBH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |