C15H17NO3 — CID 84637748
6-methoxy-8-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid (PubChem CID 84637748) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 6-methoxy-8-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid.
| Compound Name | 6-methoxy-8-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 84637748 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 6-methoxy-8-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid |
| SMILES | COc1cc(C)c2[nH]c3c(c2c1)CC(C(=O)O)CC3 |
| InChI | InChI=1S/C15H17NO3/c1-8-5-10(19-2)7-12-11-6-9(15(17)18)3-4-13(11)16-14(8)12/h5,7,9,16H,3-4,6H2,1-2H3,(H,17,18) |
| InChIKey | AUPWVXMBCGOCIE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|