C13H20N2O2S — CID 84640902
(3,4,5,6-tetramethyl-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazin-2-yl)methanamine (PubChem CID 84640902) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is (3,4,5,6-tetramethyl-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazin-2-yl)methanamine.
| Compound Name | (3,4,5,6-tetramethyl-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazin-2-yl)methanamine |
|---|---|
| PubChem CID | 84640902 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (3,4,5,6-tetramethyl-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazin-2-yl)methanamine |
| SMILES | Cc1ccc2c(c1C)N(C)C(C)C(CN)S2(=O)=O |
| InChI | InChI=1S/C13H20N2O2S/c1-8-5-6-11-13(9(8)2)15(4)10(3)12(7-14)18(11,16)17/h5-6,10,12H,7,14H2,1-4H3 |
| InChIKey | BHVRXCYTAMUDBV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |