C14H14F3NO2 — CID 84643492
3-[5,7-dimethyl-2-(trifluoromethyl)-1H-indol-3-yl]propanoic acid (PubChem CID 84643492) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is 3-[5,7-dimethyl-2-(trifluoromethyl)-1H-indol-3-yl]propanoic acid.
| Compound Name | 3-[5,7-dimethyl-2-(trifluoromethyl)-1H-indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 84643492 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-[5,7-dimethyl-2-(trifluoromethyl)-1H-indol-3-yl]propanoic acid |
| SMILES | Cc1cc(C)c2[nH]c(C(F)(F)F)c(CCC(=O)O)c2c1 |
| InChI | InChI=1S/C14H14F3NO2/c1-7-5-8(2)12-10(6-7)9(3-4-11(19)20)13(18-12)14(15,16)17/h5-6,18H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | GVUPPFWSYFMAND-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |