C14H17BrN2 — CID 84643998
7-bromo-N,9-dimethyl-1,2,3,4-tetrahydrocarbazol-1-amine (PubChem CID 84643998) has the molecular formula C14H17BrN2 and a molecular weight of 293.21 g/mol. Its IUPAC name is 7-bromo-N,9-dimethyl-1,2,3,4-tetrahydrocarbazol-1-amine.
| Compound Name | 7-bromo-N,9-dimethyl-1,2,3,4-tetrahydrocarbazol-1-amine |
|---|---|
| PubChem CID | 84643998 |
| Molecular Formula | C14H17BrN2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 7-bromo-N,9-dimethyl-1,2,3,4-tetrahydrocarbazol-1-amine |
| SMILES | CNC1CCCc2c1n(C)c1cc(Br)ccc21 |
| InChI | InChI=1S/C14H17BrN2/c1-16-12-5-3-4-11-10-7-6-9(15)8-13(10)17(2)14(11)12/h6-8,12,16H,3-5H2,1-2H3 |
| InChIKey | QYWPIWRRFAQSFQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|