C8H10O2 — CID 84648331
(5S,6R)-5-methylbicyclo[3.1.0]hex-2-ene-6-carboxylic acid (PubChem CID 84648331) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is (5S,6R)-5-methylbicyclo[3.1.0]hex-2-ene-6-carboxylic acid.
| Compound Name | (5S,6R)-5-methylbicyclo[3.1.0]hex-2-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 84648331 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | (5S,6R)-5-methylbicyclo[3.1.0]hex-2-ene-6-carboxylic acid |
| SMILES | C[C@]12CC=CC1[C@H]2C(=O)O |
| InChI | InChI=1S/C8H10O2/c1-8-4-2-3-5(8)6(8)7(9)10/h2-3,5-6H,4H2,1H3,(H,9,10)/t5?,6-,8-/m0/s1 |
| InChIKey | SSWJFIOJCLGGIA-SXSZQIEUSA-N |
| XLogP | 1.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|