C13H21ClO — CID 22887861
4-chloro-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one (PubChem CID 22887861) has the molecular formula C13H21ClO and a molecular weight of 228.76 g/mol. Its IUPAC name is 4-chloro-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one.
| Compound Name | 4-chloro-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one |
|---|---|
| PubChem CID | 22887861 |
| Molecular Formula | C13H21ClO |
| Molecular Weight | 228.76 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 4-chloro-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one |
| SMILES | CC1C=CCC(C)(C)C1C(=O)CCCCl |
| InChI | InChI=1S/C13H21ClO/c1-10-6-4-8-13(2,3)12(10)11(15)7-5-9-14/h4,6,10,12H,5,7-9H2,1-3H3 |
| InChIKey | KBCSSGZPLFYJLY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|