C5H7F2NS — CID 84649507
2-(3,3-difluoropropylsulfanyl)acetonitrile (PubChem CID 84649507) has the molecular formula C5H7F2NS and a molecular weight of 151.18 g/mol. Its IUPAC name is 2-(3,3-difluoropropylsulfanyl)acetonitrile.
| Compound Name | 2-(3,3-difluoropropylsulfanyl)acetonitrile |
|---|---|
| PubChem CID | 84649507 |
| Molecular Formula | C5H7F2NS |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.03 |
| IUPAC Name | 2-(3,3-difluoropropylsulfanyl)acetonitrile |
| SMILES | N#CCSCCC(F)F |
| InChI | InChI=1S/C5H7F2NS/c6-5(7)1-3-9-4-2-8/h5H,1,3-4H2 |
| InChIKey | VBTDETUCZDUOJE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|