C5H3Cl2NO — CID 84651754
3,5-dichloro-1H-pyrrole-2-carbaldehyde (PubChem CID 84651754) has the molecular formula C5H3Cl2NO and a molecular weight of 163.99 g/mol. Its IUPAC name is 3,5-dichloro-1H-pyrrole-2-carbaldehyde.
| Compound Name | 3,5-dichloro-1H-pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 84651754 |
| Molecular Formula | C5H3Cl2NO |
| Molecular Weight | 163.99 g/mol |
| Exact Mass | 162.96 |
| IUPAC Name | 3,5-dichloro-1H-pyrrole-2-carbaldehyde |
| SMILES | O=Cc1[nH]c(Cl)cc1Cl |
| InChI | InChI=1S/C5H3Cl2NO/c6-3-1-5(7)8-4(3)2-9/h1-2,8H |
| InChIKey | HOIGOJDYFSINJR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.99 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|