C7H6Cl2N2O2 — CID 23242570
N-(4,6-dichloro-2-oxo-1H-pyridin-3-yl)acetamide (PubChem CID 23242570) has the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. Its IUPAC name is N-(4,6-dichloro-2-oxo-1H-pyridin-3-yl)acetamide.
| Compound Name | N-(4,6-dichloro-2-oxo-1H-pyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 23242570 |
| Molecular Formula | C7H6Cl2N2O2 |
| Molecular Weight | 221.04 g/mol |
| Exact Mass | 219.98 |
| IUPAC Name | N-(4,6-dichloro-2-oxo-1H-pyridin-3-yl)acetamide |
| SMILES | CC(=O)Nc1c(Cl)cc(Cl)[nH]c1=O |
| InChI | InChI=1S/C7H6Cl2N2O2/c1-3(12)10-6-4(8)2-5(9)11-7(6)13/h2H,1H3,(H,10,12)(H,11,13) |
| InChIKey | JMCDQWJSEKGXIT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.04 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|