C5H6F2N4O — CID 84655435
1-(3,3-difluoropropyl)tetrazole-5-carbaldehyde (PubChem CID 84655435) has the molecular formula C5H6F2N4O and a molecular weight of 176.13 g/mol. Its IUPAC name is 1-(3,3-difluoropropyl)tetrazole-5-carbaldehyde.
| Compound Name | 1-(3,3-difluoropropyl)tetrazole-5-carbaldehyde |
|---|---|
| PubChem CID | 84655435 |
| Molecular Formula | C5H6F2N4O |
| Molecular Weight | 176.13 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 1-(3,3-difluoropropyl)tetrazole-5-carbaldehyde |
| SMILES | O=Cc1nnnn1CCC(F)F |
| InChI | InChI=1S/C5H6F2N4O/c6-4(7)1-2-11-5(3-12)8-9-10-11/h3-4H,1-2H2 |
| InChIKey | QSRAYKGNVVTVLQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.13 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|