C6H8F2N4O — CID 84662391
1-[1-(3,3-difluoropropyl)tetrazol-5-yl]ethanone (PubChem CID 84662391) has the molecular formula C6H8F2N4O and a molecular weight of 190.15 g/mol. Its IUPAC name is 1-[1-(3,3-difluoropropyl)tetrazol-5-yl]ethanone.
| Compound Name | 1-[1-(3,3-difluoropropyl)tetrazol-5-yl]ethanone |
|---|---|
| PubChem CID | 84662391 |
| Molecular Formula | C6H8F2N4O |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1-[1-(3,3-difluoropropyl)tetrazol-5-yl]ethanone |
| SMILES | CC(=O)c1nnnn1CCC(F)F |
| InChI | InChI=1S/C6H8F2N4O/c1-4(13)6-9-10-11-12(6)3-2-5(7)8/h5H,2-3H2,1H3 |
| InChIKey | CGTNYFCVFOUWJA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |