C9H9NO3 — CID 84656757
5-(2-aminoethyl)-1,3-benzodioxol-2-one (PubChem CID 84656757) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is 5-(2-aminoethyl)-1,3-benzodioxol-2-one.
| Compound Name | 5-(2-aminoethyl)-1,3-benzodioxol-2-one |
|---|---|
| PubChem CID | 84656757 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 5-(2-aminoethyl)-1,3-benzodioxol-2-one |
| SMILES | NCCc1ccc2oc(=O)oc2c1 |
| InChI | InChI=1S/C9H9NO3/c10-4-3-6-1-2-7-8(5-6)13-9(11)12-7/h1-2,5H,3-4,10H2 |
| InChIKey | YKMZARMMKICBDO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 69.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |