C10H12FNO — CID 84657879
3-(1-fluoroethyl)-2,3-dihydro-1H-indol-7-ol (PubChem CID 84657879) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is 3-(1-fluoroethyl)-2,3-dihydro-1H-indol-7-ol.
| Compound Name | 3-(1-fluoroethyl)-2,3-dihydro-1H-indol-7-ol |
|---|---|
| PubChem CID | 84657879 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-(1-fluoroethyl)-2,3-dihydro-1H-indol-7-ol |
| SMILES | CC(F)C1CNc2c(O)cccc21 |
| InChI | InChI=1S/C10H12FNO/c1-6(11)8-5-12-10-7(8)3-2-4-9(10)13/h2-4,6,8,12-13H,5H2,1H3 |
| InChIKey | CEFALXNLQVGHRR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|