C7H4ClN3O — CID 84658223
3-chloroimidazo[1,2-a]pyrazine-8-carbaldehyde (PubChem CID 84658223) has the molecular formula C7H4ClN3O and a molecular weight of 181.58 g/mol. Its IUPAC name is 3-chloroimidazo[1,2-a]pyrazine-8-carbaldehyde.
| Compound Name | 3-chloroimidazo[1,2-a]pyrazine-8-carbaldehyde |
|---|---|
| PubChem CID | 84658223 |
| Molecular Formula | C7H4ClN3O |
| Molecular Weight | 181.58 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 3-chloroimidazo[1,2-a]pyrazine-8-carbaldehyde |
| SMILES | O=Cc1nccn2c(Cl)cnc12 |
| InChI | InChI=1S/C7H4ClN3O/c8-6-3-10-7-5(4-12)9-1-2-11(6)7/h1-4H |
| InChIKey | ASKRGIFZFWCORH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.58 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|