C5H3ClN4S — CID 130520880
8-chloro-2H-[1,2,4]triazolo[4,3-a]pyrazine-3-thione (PubChem CID 130520880) has the molecular formula C5H3ClN4S and a molecular weight of 186.63 g/mol. Its IUPAC name is 8-chloro-2H-[1,2,4]triazolo[4,3-a]pyrazine-3-thione.
| Compound Name | 8-chloro-2H-[1,2,4]triazolo[4,3-a]pyrazine-3-thione |
|---|---|
| PubChem CID | 130520880 |
| Molecular Formula | C5H3ClN4S |
| Molecular Weight | 186.63 g/mol |
| Exact Mass | 185.98 |
| IUPAC Name | 8-chloro-2H-[1,2,4]triazolo[4,3-a]pyrazine-3-thione |
| SMILES | S=c1[nH]nc2c(Cl)nccn12 |
| InChI | InChI=1S/C5H3ClN4S/c6-3-4-8-9-5(11)10(4)2-1-7-3/h1-2H,(H,9,11) |
| InChIKey | UBLJIQPGJGAUFB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.63 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|