C9H11ClN4O — CID 107939390
8-chloro-3-(propoxymethyl)-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 107939390) has the molecular formula C9H11ClN4O and a molecular weight of 226.67 g/mol. Its IUPAC name is 8-chloro-3-(propoxymethyl)-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-chloro-3-(propoxymethyl)-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 107939390 |
| Molecular Formula | C9H11ClN4O |
| Molecular Weight | 226.67 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 8-chloro-3-(propoxymethyl)-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCCOCc1nnc2c(Cl)nccn12 |
| InChI | InChI=1S/C9H11ClN4O/c1-2-5-15-6-7-12-13-9-8(10)11-3-4-14(7)9/h3-4H,2,5-6H2,1H3 |
| InChIKey | CMRAECFJPWSZGD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.67 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|