C10H12ClN3O — CID 53485966
8-(chloromethyl)-3-(ethoxymethyl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 53485966) has the molecular formula C10H12ClN3O and a molecular weight of 225.68 g/mol. Its IUPAC name is 8-(chloromethyl)-3-(ethoxymethyl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 8-(chloromethyl)-3-(ethoxymethyl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 53485966 |
| Molecular Formula | C10H12ClN3O |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 8-(chloromethyl)-3-(ethoxymethyl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CCOCc1nnc2c(CCl)cccn12 |
| InChI | InChI=1S/C10H12ClN3O/c1-2-15-7-9-12-13-10-8(6-11)4-3-5-14(9)10/h3-5H,2,6-7H2,1H3 |
| InChIKey | LKOVACPVHCLNFL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|