About (6-chloropyrazolo[1,5-a]pyrimidin-2-yl)methanamine
(6-chloropyrazolo[1,5-a]pyrimidin-2-yl)methanamine (PubChem CID 84658788) has the molecular formula C7H7ClN4
and a molecular weight of 182.61 g/mol. Its IUPAC name is (6-chloropyrazolo[1,5-a]pyrimidin-2-yl)methanamine.
Analyze (6-chloropyrazolo[1,5-a]pyrimidin-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloropyrazolo[1,5-a]pyrimidin-2-yl)methanamine?
The IUPAC name of (6-chloropyrazolo[1,5-a]pyrimidin-2-yl)methanamine (CID 84658788) is (6-chloropyrazolo[1,5-a]pyrimidin-2-yl)methanamine.
What is the SMILES notation for (6-chloropyrazolo[1,5-a]pyrimidin-2-yl)methanamine?
The canonical SMILES for (6-chloropyrazolo[1,5-a]pyrimidin-2-yl)methanamine is NCc1cc2ncc(Cl)cn2n1.
What is the InChIKey of (6-chloropyrazolo[1,5-a]pyrimidin-2-yl)methanamine?
The InChIKey is NBNQLXGSKYSVSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN4/c8-5-3-10-7-1-6(2-9)11-12(7)4-5/h1,3-4H,2,9H2.
What are the key properties of (6-chloropyrazolo[1,5-a]pyrimidin-2-yl)methanamine?
(6-chloropyrazolo[1,5-a]pyrimidin-2-yl)methanamine has a molecular weight of 182.61 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloropyrazolo[1,5-a]pyrimidin-2-yl)methanamine is sourced from PubChem (CID 84658788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).