C9H7Cl3N4 — CID 13163346
[2-(2,4,6-trichlorophenyl)triazol-4-yl]methanamine (PubChem CID 13163346) has the molecular formula C9H7Cl3N4 and a molecular weight of 277.54 g/mol. Its IUPAC name is [2-(2,4,6-trichlorophenyl)triazol-4-yl]methanamine.
| Compound Name | [2-(2,4,6-trichlorophenyl)triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 13163346 |
| Molecular Formula | C9H7Cl3N4 |
| Molecular Weight | 277.54 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | [2-(2,4,6-trichlorophenyl)triazol-4-yl]methanamine |
| SMILES | NCc1cnn(-c2c(Cl)cc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C9H7Cl3N4/c10-5-1-7(11)9(8(12)2-5)16-14-4-6(3-13)15-16/h1-2,4H,3,13H2 |
| InChIKey | YHKWGQYWJMKTEJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |