C9H8N2O3 — CID 84663737
7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carbaldehyde (PubChem CID 84663737) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carbaldehyde.
| Compound Name | 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 84663737 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carbaldehyde |
| SMILES | CCOc1ccnc2nc(C=O)oc12 |
| InChI | InChI=1S/C9H8N2O3/c1-2-13-6-3-4-10-9-8(6)14-7(5-12)11-9/h3-5H,2H2,1H3 |
| InChIKey | CRBXUHOBVLTPAS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|