About 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid
7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid (PubChem CID 84675802) has the molecular formula C9H8N2O4
and a molecular weight of 208.17 g/mol. Its IUPAC name is 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid |
| PubChem CID | 84675802 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid |
| SMILES | CCOc1ccnc2nc(C(=O)O)oc12 |
| InChI | InChI=1S/C9H8N2O4/c1-2-14-5-3-4-10-7-6(5)15-8(11-7)9(12)13/h3-4H,2H2,1H3,(H,12,13) |
| InChIKey | IBOLVFKNONWAFR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid?
The IUPAC name of 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid (CID 84675802) is 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid.
What is the SMILES notation for 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid?
The canonical SMILES for 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid is CCOc1ccnc2nc(C(=O)O)oc12.
What is the InChIKey of 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid?
The InChIKey is IBOLVFKNONWAFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O4/c1-2-14-5-3-4-10-7-6(5)15-8(11-7)9(12)13/h3-4H,2H2,1H3,(H,12,13).
What are the key properties of 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid?
7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid has a molecular weight of 208.17 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-[1,3]oxazolo[4,5-b]pyridine-2-carboxylic acid is sourced from PubChem (CID 84675802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).