C11H14O3 — CID 84665384
1-[4-(1,3-dioxolan-4-yl)phenyl]ethanol (PubChem CID 84665384) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-[4-(1,3-dioxolan-4-yl)phenyl]ethanol.
| Compound Name | 1-[4-(1,3-dioxolan-4-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 84665384 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-[4-(1,3-dioxolan-4-yl)phenyl]ethanol |
| SMILES | CC(O)c1ccc(C2COCO2)cc1 |
| InChI | InChI=1S/C11H14O3/c1-8(12)9-2-4-10(5-3-9)11-6-13-7-14-11/h2-5,8,11-12H,6-7H2,1H3 |
| InChIKey | IZECDXOPHYFADQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |