2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid

C8H8ClNO3 — CID 84670281

IUPAC2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid
SMILESO=C(O)C1CCCc2nc(Cl)oc21
InChIInChI=1S/C8H8ClNO3/c9-8-10-5-3-1-2-4(7(11)12)6(5)13-8/h4H,1-3H2,(H,11,12)
InChIKeyMPHQIIPLKZBJDU-UHFFFAOYSA-N
MW201.61 g/mol
LogP1.83
Rot. Bonds1

About 2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid

2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid (PubChem CID 84670281) has the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. Its IUPAC name is 2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid.

Molecular Properties

Compound Name2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid
PubChem CID84670281
Molecular FormulaC8H8ClNO3
Molecular Weight201.61 g/mol
Exact Mass201.02
IUPAC Name2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid
SMILESO=C(O)C1CCCc2nc(Cl)oc21
InChIInChI=1S/C8H8ClNO3/c9-8-10-5-3-1-2-4(7(11)12)6(5)13-8/h4H,1-3H2,(H,11,12)
InChIKeyMPHQIIPLKZBJDU-UHFFFAOYSA-N
XLogP1.83
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.61
LogP ≤ 51.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid?
The IUPAC name of 2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid (CID 84670281) is 2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid.
What is the SMILES notation for 2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid?
The canonical SMILES for 2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid is O=C(O)C1CCCc2nc(Cl)oc21.
What is the InChIKey of 2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid?
The InChIKey is MPHQIIPLKZBJDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO3/c9-8-10-5-3-1-2-4(7(11)12)6(5)13-8/h4H,1-3H2,(H,11,12).
What are the key properties of 2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid?
2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid has a molecular weight of 201.61 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,5,6,7-tetrahydro-1,3-benzoxazole-7-carboxylic acid is sourced from PubChem (CID 84670281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).