About (7R)-4,5,6,7-tetrahydro-1,3-benzothiazole-7-carboxylic acid
(7R)-4,5,6,7-tetrahydro-1,3-benzothiazole-7-carboxylic acid (PubChem CID 124547744) has the molecular formula C8H9NO2S
and a molecular weight of 183.23 g/mol. Its IUPAC name is (7R)-4,5,6,7-tetrahydro-1,3-benzothiazole-7-carboxylic acid.
Analyze (7R)-4,5,6,7-tetrahydro-1,3-benzothiazole-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-4,5,6,7-tetrahydro-1,3-benzothiazole-7-carboxylic acid?
The IUPAC name of (7R)-4,5,6,7-tetrahydro-1,3-benzothiazole-7-carboxylic acid (CID 124547744) is (7R)-4,5,6,7-tetrahydro-1,3-benzothiazole-7-carboxylic acid.
What is the SMILES notation for (7R)-4,5,6,7-tetrahydro-1,3-benzothiazole-7-carboxylic acid?
The canonical SMILES for (7R)-4,5,6,7-tetrahydro-1,3-benzothiazole-7-carboxylic acid is O=C(O)[C@H]1CCCc2ncsc21.
What is the InChIKey of (7R)-4,5,6,7-tetrahydro-1,3-benzothiazole-7-carboxylic acid?
The InChIKey is ZLDYXIBJPUNUPD-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H9NO2S/c10-8(11)5-2-1-3-6-7(5)12-4-9-6/h4-5H,1-3H2,(H,10,11)/t5-/m0/s1.
What are the key properties of (7R)-4,5,6,7-tetrahydro-1,3-benzothiazole-7-carboxylic acid?
(7R)-4,5,6,7-tetrahydro-1,3-benzothiazole-7-carboxylic acid has a molecular weight of 183.23 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-4,5,6,7-tetrahydro-1,3-benzothiazole-7-carboxylic acid is sourced from PubChem (CID 124547744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).