C9H8F2OS — CID 84670647
4-(2,2-difluoroethylsulfanyl)benzaldehyde (PubChem CID 84670647) has the molecular formula C9H8F2OS and a molecular weight of 202.23 g/mol. Its IUPAC name is 4-(2,2-difluoroethylsulfanyl)benzaldehyde.
| Compound Name | 4-(2,2-difluoroethylsulfanyl)benzaldehyde |
|---|---|
| PubChem CID | 84670647 |
| Molecular Formula | C9H8F2OS |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 4-(2,2-difluoroethylsulfanyl)benzaldehyde |
| SMILES | O=Cc1ccc(SCC(F)F)cc1 |
| InChI | InChI=1S/C9H8F2OS/c10-9(11)6-13-8-3-1-7(5-12)2-4-8/h1-5,9H,6H2 |
| InChIKey | VQZLNRDUFOHOET-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|