5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid

C6H3ClN2O2S — CID 84671102

IUPAC5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid
SMILESO=C(O)c1n[nH]c2cc(Cl)sc12
InChIInChI=1S/C6H3ClN2O2S/c7-3-1-2-5(12-3)4(6(10)11)9-8-2/h1H,(H,8,9)(H,10,11)
InChIKeyRKGYONHPBBZXHT-UHFFFAOYSA-N
MW202.62 g/mol
LogP1.98
Rot. Bonds1

About 5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid

5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid (PubChem CID 84671102) has the molecular formula C6H3ClN2O2S and a molecular weight of 202.62 g/mol. Its IUPAC name is 5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid.

Molecular Properties

Compound Name5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid
PubChem CID84671102
Molecular FormulaC6H3ClN2O2S
Molecular Weight202.62 g/mol
Exact Mass201.96
IUPAC Name5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid
SMILESO=C(O)c1n[nH]c2cc(Cl)sc12
InChIInChI=1S/C6H3ClN2O2S/c7-3-1-2-5(12-3)4(6(10)11)9-8-2/h1H,(H,8,9)(H,10,11)
InChIKeyRKGYONHPBBZXHT-UHFFFAOYSA-N
XLogP1.98
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.62
LogP ≤ 51.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid?
The IUPAC name of 5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid (CID 84671102) is 5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid.
What is the SMILES notation for 5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid?
The canonical SMILES for 5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid is O=C(O)c1n[nH]c2cc(Cl)sc12.
What is the InChIKey of 5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid?
The InChIKey is RKGYONHPBBZXHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClN2O2S/c7-3-1-2-5(12-3)4(6(10)11)9-8-2/h1H,(H,8,9)(H,10,11).
What are the key properties of 5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid?
5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid has a molecular weight of 202.62 g/mol, XLogP of 1.98, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid is sourced from PubChem (CID 84671102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).