C6H3ClN2O2S — CID 84671102
5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid (PubChem CID 84671102) has the molecular formula C6H3ClN2O2S and a molecular weight of 202.62 g/mol. Its IUPAC name is 5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid.
| Compound Name | 5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 84671102 |
| Molecular Formula | C6H3ClN2O2S |
| Molecular Weight | 202.62 g/mol |
| Exact Mass | 201.96 |
| IUPAC Name | 5-chloro-1H-thieno[3,2-c]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1n[nH]c2cc(Cl)sc12 |
| InChI | InChI=1S/C6H3ClN2O2S/c7-3-1-2-5(12-3)4(6(10)11)9-8-2/h1H,(H,8,9)(H,10,11) |
| InChIKey | RKGYONHPBBZXHT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.62 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |