C11H13NO3 — CID 84675035
6,6-dimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxylic acid (PubChem CID 84675035) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 6,6-dimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxylic acid.
| Compound Name | 6,6-dimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 84675035 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 6,6-dimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxylic acid |
| SMILES | CC1(C)CC(=O)c2cc(C(=O)O)[nH]c2C1 |
| InChI | InChI=1S/C11H13NO3/c1-11(2)4-8-6(9(13)5-11)3-7(12-8)10(14)15/h3,12H,4-5H2,1-2H3,(H,14,15) |
| InChIKey | MFDJGKVFKKVYOX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |