C12H18O3 — CID 84677809
1-(2-ethyl-3,4-dimethoxyphenyl)ethanol (PubChem CID 84677809) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-(2-ethyl-3,4-dimethoxyphenyl)ethanol.
| Compound Name | 1-(2-ethyl-3,4-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 84677809 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-(2-ethyl-3,4-dimethoxyphenyl)ethanol |
| SMILES | CCc1c(C(C)O)ccc(OC)c1OC |
| InChI | InChI=1S/C12H18O3/c1-5-9-10(8(2)13)6-7-11(14-3)12(9)15-4/h6-8,13H,5H2,1-4H3 |
| InChIKey | KVVGZVIPSFOCNV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |