C16H27NO3 — CID 143569766
ethane;2-(2-ethyl-3,4-dimethoxyphenyl)butanamide (PubChem CID 143569766) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is ethane;2-(2-ethyl-3,4-dimethoxyphenyl)butanamide.
| Compound Name | ethane;2-(2-ethyl-3,4-dimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 143569766 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | ethane;2-(2-ethyl-3,4-dimethoxyphenyl)butanamide |
| SMILES | CC.CCc1c(C(CC)C(N)=O)ccc(OC)c1OC |
| InChI | InChI=1S/C14H21NO3.C2H6/c1-5-9-11(10(6-2)14(15)16)7-8-12(17-3)13(9)18-4;1-2/h7-8,10H,5-6H2,1-4H3,(H2,15,16);1-2H3 |
| InChIKey | XPYSJIPYMCULGJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |