C12H16O4S — CID 175747289
(2-ethyl-3,4-dimethoxyphenyl)sulfanyl acetate (PubChem CID 175747289) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is (2-ethyl-3,4-dimethoxyphenyl)sulfanyl acetate.
| Compound Name | (2-ethyl-3,4-dimethoxyphenyl)sulfanyl acetate |
|---|---|
| PubChem CID | 175747289 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (2-ethyl-3,4-dimethoxyphenyl)sulfanyl acetate |
| SMILES | CCc1c(SOC(C)=O)ccc(OC)c1OC |
| InChI | InChI=1S/C12H16O4S/c1-5-9-11(17-16-8(2)13)7-6-10(14-3)12(9)15-4/h6-7H,5H2,1-4H3 |
| InChIKey | YAGLPXNRSSRPQS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|