About 2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole
2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole (PubChem CID 84681912) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole |
| PubChem CID | 84681912 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole |
| SMILES | COc1ccc(C2(C3=NCCN3)CC2)cc1 |
| InChI | InChI=1S/C13H16N2O/c1-16-11-4-2-10(3-5-11)13(6-7-13)12-14-8-9-15-12/h2-5H,6-9H2,1H3,(H,14,15) |
| InChIKey | JHNYVSMBYNEELJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole (CID 84681912) is 2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole is COc1ccc(C2(C3=NCCN3)CC2)cc1.
What is the InChIKey of 2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole?
The InChIKey is JHNYVSMBYNEELJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c1-16-11-4-2-10(3-5-11)13(6-7-13)12-14-8-9-15-12/h2-5H,6-9H2,1H3,(H,14,15).
What are the key properties of 2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole?
2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole has a molecular weight of 216.28 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-methoxyphenyl)cyclopropyl]-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 84681912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).