C7H11N3O3S — CID 84682670
2-amino-2-(2-methylsulfonylpyrimidin-4-yl)ethanol (PubChem CID 84682670) has the molecular formula C7H11N3O3S and a molecular weight of 217.25 g/mol. Its IUPAC name is 2-amino-2-(2-methylsulfonylpyrimidin-4-yl)ethanol.
| Compound Name | 2-amino-2-(2-methylsulfonylpyrimidin-4-yl)ethanol |
|---|---|
| PubChem CID | 84682670 |
| Molecular Formula | C7H11N3O3S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 2-amino-2-(2-methylsulfonylpyrimidin-4-yl)ethanol |
| SMILES | CS(=O)(=O)c1nccc(C(N)CO)n1 |
| InChI | InChI=1S/C7H11N3O3S/c1-14(12,13)7-9-3-2-6(10-7)5(8)4-11/h2-3,5,11H,4,8H2,1H3 |
| InChIKey | URTXDVUMAGAMHP-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |