C10H12ClF2N — CID 84685245
1-(3-chlorophenyl)-3,3-difluorobutan-2-amine (PubChem CID 84685245) has the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3,3-difluorobutan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-3,3-difluorobutan-2-amine |
|---|---|
| PubChem CID | 84685245 |
| Molecular Formula | C10H12ClF2N |
| Molecular Weight | 219.66 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 1-(3-chlorophenyl)-3,3-difluorobutan-2-amine |
| SMILES | CC(F)(F)C(N)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H12ClF2N/c1-10(12,13)9(14)6-7-3-2-4-8(11)5-7/h2-5,9H,6,14H2,1H3 |
| InChIKey | RSXMMLAKXQKNPF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.66 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |