C10H10ClF3O — CID 115042879
2-[(3-chlorophenyl)methyl]-3,3,3-trifluoropropan-1-ol (PubChem CID 115042879) has the molecular formula C10H10ClF3O and a molecular weight of 238.64 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-3,3,3-trifluoropropan-1-ol.
| Compound Name | 2-[(3-chlorophenyl)methyl]-3,3,3-trifluoropropan-1-ol |
|---|---|
| PubChem CID | 115042879 |
| Molecular Formula | C10H10ClF3O |
| Molecular Weight | 238.64 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-3,3,3-trifluoropropan-1-ol |
| SMILES | OCC(Cc1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C10H10ClF3O/c11-9-3-1-2-7(5-9)4-8(6-15)10(12,13)14/h1-3,5,8,15H,4,6H2 |
| InChIKey | UTFZCTKUVDYSND-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.64 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |