About 5-pyrrolidin-3-yloxy-1,2-benzothiazole
5-pyrrolidin-3-yloxy-1,2-benzothiazole (PubChem CID 84685930) has the molecular formula C11H12N2OS
and a molecular weight of 220.30 g/mol. Its IUPAC name is 5-pyrrolidin-3-yloxy-1,2-benzothiazole.
Molecular Properties
| Compound Name | 5-pyrrolidin-3-yloxy-1,2-benzothiazole |
| PubChem CID | 84685930 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 5-pyrrolidin-3-yloxy-1,2-benzothiazole |
| SMILES | c1cc2sncc2cc1OC1CCNC1 |
| InChI | InChI=1S/C11H12N2OS/c1-2-11-8(6-13-15-11)5-9(1)14-10-3-4-12-7-10/h1-2,5-6,10,12H,3-4,7H2 |
| InChIKey | GSBPSXXFHFCUKF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-pyrrolidin-3-yloxy-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrrolidin-3-yloxy-1,2-benzothiazole?
The IUPAC name of 5-pyrrolidin-3-yloxy-1,2-benzothiazole (CID 84685930) is 5-pyrrolidin-3-yloxy-1,2-benzothiazole.
What is the SMILES notation for 5-pyrrolidin-3-yloxy-1,2-benzothiazole?
The canonical SMILES for 5-pyrrolidin-3-yloxy-1,2-benzothiazole is c1cc2sncc2cc1OC1CCNC1.
What is the InChIKey of 5-pyrrolidin-3-yloxy-1,2-benzothiazole?
The InChIKey is GSBPSXXFHFCUKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2OS/c1-2-11-8(6-13-15-11)5-9(1)14-10-3-4-12-7-10/h1-2,5-6,10,12H,3-4,7H2.
What are the key properties of 5-pyrrolidin-3-yloxy-1,2-benzothiazole?
5-pyrrolidin-3-yloxy-1,2-benzothiazole has a molecular weight of 220.30 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrrolidin-3-yloxy-1,2-benzothiazole is sourced from PubChem (CID 84685930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).