About methyl 8-methoxy-1,2,3,4-tetrahydroisoquinoline-7-carboxylate
methyl 8-methoxy-1,2,3,4-tetrahydroisoquinoline-7-carboxylate (PubChem CID 84686653) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is methyl 8-methoxy-1,2,3,4-tetrahydroisoquinoline-7-carboxylate.
Analyze methyl 8-methoxy-1,2,3,4-tetrahydroisoquinoline-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-methoxy-1,2,3,4-tetrahydroisoquinoline-7-carboxylate?
The IUPAC name of methyl 8-methoxy-1,2,3,4-tetrahydroisoquinoline-7-carboxylate (CID 84686653) is methyl 8-methoxy-1,2,3,4-tetrahydroisoquinoline-7-carboxylate.
What is the SMILES notation for methyl 8-methoxy-1,2,3,4-tetrahydroisoquinoline-7-carboxylate?
The canonical SMILES for methyl 8-methoxy-1,2,3,4-tetrahydroisoquinoline-7-carboxylate is COC(=O)c1ccc2c(c1OC)CNCC2.
What is the InChIKey of methyl 8-methoxy-1,2,3,4-tetrahydroisoquinoline-7-carboxylate?
The InChIKey is ZSNYEAXZVBFTQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c1-15-11-9(12(14)16-2)4-3-8-5-6-13-7-10(8)11/h3-4,13H,5-7H2,1-2H3.
What are the key properties of methyl 8-methoxy-1,2,3,4-tetrahydroisoquinoline-7-carboxylate?
methyl 8-methoxy-1,2,3,4-tetrahydroisoquinoline-7-carboxylate has a molecular weight of 221.26 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-methoxy-1,2,3,4-tetrahydroisoquinoline-7-carboxylate is sourced from PubChem (CID 84686653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).