C12H8FN3O — CID 84692482
2-(2-fluorophenyl)-[1,3]oxazolo[5,4-b]pyridin-7-amine (PubChem CID 84692482) has the molecular formula C12H8FN3O and a molecular weight of 229.21 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-[1,3]oxazolo[5,4-b]pyridin-7-amine.
| Compound Name | 2-(2-fluorophenyl)-[1,3]oxazolo[5,4-b]pyridin-7-amine |
|---|---|
| PubChem CID | 84692482 |
| Molecular Formula | C12H8FN3O |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-(2-fluorophenyl)-[1,3]oxazolo[5,4-b]pyridin-7-amine |
| SMILES | Nc1ccnc2oc(-c3ccccc3F)nc12 |
| InChI | InChI=1S/C12H8FN3O/c13-8-4-2-1-3-7(8)11-16-10-9(14)5-6-15-12(10)17-11/h1-6H,(H2,14,15) |
| InChIKey | STQOWJOPYCNGKC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |