2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid

C9H13F2N3O2 — CID 84696446

IUPAC2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid
SMILESCC(C(=O)O)c1ncnn1CCC(C)(F)F
InChIInChI=1S/C9H13F2N3O2/c1-6(8(15)16)7-12-5-13-14(7)4-3-9(2,10)11/h5-6H,3-4H2,1-2H3,(H,15,16)
InChIKeyHJLZXCJMFFARSK-UHFFFAOYSA-N
MW233.22 g/mol
LogP1.51
Rot. Bonds5

About 2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid

2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid (PubChem CID 84696446) has the molecular formula C9H13F2N3O2 and a molecular weight of 233.22 g/mol. Its IUPAC name is 2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid.

Molecular Properties

Compound Name2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid
PubChem CID84696446
Molecular FormulaC9H13F2N3O2
Molecular Weight233.22 g/mol
Exact Mass233.10
IUPAC Name2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid
SMILESCC(C(=O)O)c1ncnn1CCC(C)(F)F
InChIInChI=1S/C9H13F2N3O2/c1-6(8(15)16)7-12-5-13-14(7)4-3-9(2,10)11/h5-6H,3-4H2,1-2H3,(H,15,16)
InChIKeyHJLZXCJMFFARSK-UHFFFAOYSA-N
XLogP1.51
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.22
LogP ≤ 51.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid?
The IUPAC name of 2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid (CID 84696446) is 2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid.
What is the SMILES notation for 2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid?
The canonical SMILES for 2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid is CC(C(=O)O)c1ncnn1CCC(C)(F)F.
What is the InChIKey of 2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid?
The InChIKey is HJLZXCJMFFARSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3O2/c1-6(8(15)16)7-12-5-13-14(7)4-3-9(2,10)11/h5-6H,3-4H2,1-2H3,(H,15,16).
What are the key properties of 2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid?
2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid has a molecular weight of 233.22 g/mol, XLogP of 1.51, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,3-difluorobutyl)-1,2,4-triazol-3-yl]propanoic acid is sourced from PubChem (CID 84696446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).