C7H10FN3O2 — CID 84660872
2-[2-(2-fluoroethyl)-1,2,4-triazol-3-yl]propanoic acid (PubChem CID 84660872) has the molecular formula C7H10FN3O2 and a molecular weight of 187.17 g/mol. Its IUPAC name is 2-[2-(2-fluoroethyl)-1,2,4-triazol-3-yl]propanoic acid.
| Compound Name | 2-[2-(2-fluoroethyl)-1,2,4-triazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 84660872 |
| Molecular Formula | C7H10FN3O2 |
| Molecular Weight | 187.17 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-[2-(2-fluoroethyl)-1,2,4-triazol-3-yl]propanoic acid |
| SMILES | CC(C(=O)O)c1ncnn1CCF |
| InChI | InChI=1S/C7H10FN3O2/c1-5(7(12)13)6-9-4-10-11(6)3-2-8/h4-5H,2-3H2,1H3,(H,12,13) |
| InChIKey | XOAJEBALHPZZPO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.17 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |