C8H13F2N3 — CID 166500003
1-(3,3-difluoropropyl)-5-propan-2-yl-1,2,4-triazole (PubChem CID 166500003) has the molecular formula C8H13F2N3 and a molecular weight of 189.21 g/mol. Its IUPAC name is 1-(3,3-difluoropropyl)-5-propan-2-yl-1,2,4-triazole.
| Compound Name | 1-(3,3-difluoropropyl)-5-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 166500003 |
| Molecular Formula | C8H13F2N3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | 1-(3,3-difluoropropyl)-5-propan-2-yl-1,2,4-triazole |
| SMILES | CC(C)c1ncnn1CCC(F)F |
| InChI | InChI=1S/C8H13F2N3/c1-6(2)8-11-5-12-13(8)4-3-7(9)10/h5-7H,3-4H2,1-2H3 |
| InChIKey | LUEKJRIBSHYLDL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |