C7H5BrF2O2 — CID 84700981
3-bromo-5-(difluoromethyl)benzene-1,2-diol (PubChem CID 84700981) has the molecular formula C7H5BrF2O2 and a molecular weight of 239.02 g/mol. Its IUPAC name is 3-bromo-5-(difluoromethyl)benzene-1,2-diol.
| Compound Name | 3-bromo-5-(difluoromethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 84700981 |
| Molecular Formula | C7H5BrF2O2 |
| Molecular Weight | 239.02 g/mol |
| Exact Mass | 237.94 |
| IUPAC Name | 3-bromo-5-(difluoromethyl)benzene-1,2-diol |
| SMILES | Oc1cc(C(F)F)cc(Br)c1O |
| InChI | InChI=1S/C7H5BrF2O2/c8-4-1-3(7(9)10)2-5(11)6(4)12/h1-2,7,11-12H |
| InChIKey | SRIAFXVKTVNCQA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.02 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|