C10H11ClFNO3 — CID 84706252
4-amino-4-(3-chloro-2-fluoro-6-hydroxyphenyl)butanoic acid (PubChem CID 84706252) has the molecular formula C10H11ClFNO3 and a molecular weight of 247.65 g/mol. Its IUPAC name is 4-amino-4-(3-chloro-2-fluoro-6-hydroxyphenyl)butanoic acid.
| Compound Name | 4-amino-4-(3-chloro-2-fluoro-6-hydroxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 84706252 |
| Molecular Formula | C10H11ClFNO3 |
| Molecular Weight | 247.65 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 4-amino-4-(3-chloro-2-fluoro-6-hydroxyphenyl)butanoic acid |
| SMILES | NC(CCC(=O)O)c1c(O)ccc(Cl)c1F |
| InChI | InChI=1S/C10H11ClFNO3/c11-5-1-3-7(14)9(10(5)12)6(13)2-4-8(15)16/h1,3,6,14H,2,4,13H2,(H,15,16) |
| InChIKey | VXWAFELQBHRRTK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.65 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|