C10H10BrN3 — CID 84707601
3-bromo-1-methyl-5-(3-methylphenyl)-1,2,4-triazole (PubChem CID 84707601) has the molecular formula C10H10BrN3 and a molecular weight of 252.12 g/mol. Its IUPAC name is 3-bromo-1-methyl-5-(3-methylphenyl)-1,2,4-triazole.
| Compound Name | 3-bromo-1-methyl-5-(3-methylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 84707601 |
| Molecular Formula | C10H10BrN3 |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 3-bromo-1-methyl-5-(3-methylphenyl)-1,2,4-triazole |
| SMILES | Cc1cccc(-c2nc(Br)nn2C)c1 |
| InChI | InChI=1S/C10H10BrN3/c1-7-4-3-5-8(6-7)9-12-10(11)13-14(9)2/h3-6H,1-2H3 |
| InChIKey | HEMZXYSYTMXWOS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |