C11H12N2O2 — CID 70622359
1-methyl-2-(3-methylphenyl)imidazole-4,5-diol (PubChem CID 70622359) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 1-methyl-2-(3-methylphenyl)imidazole-4,5-diol.
| Compound Name | 1-methyl-2-(3-methylphenyl)imidazole-4,5-diol |
|---|---|
| PubChem CID | 70622359 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 1-methyl-2-(3-methylphenyl)imidazole-4,5-diol |
| SMILES | Cc1cccc(-c2nc(O)c(O)n2C)c1 |
| InChI | InChI=1S/C11H12N2O2/c1-7-4-3-5-8(6-7)9-12-10(14)11(15)13(9)2/h3-6,14-15H,1-2H3 |
| InChIKey | VLLSVWRQOOBGHX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |