C10H14BrNS — CID 84710165
2-(4-bromo-2,5-dimethylthiophen-3-yl)pyrrolidine (PubChem CID 84710165) has the molecular formula C10H14BrNS and a molecular weight of 260.20 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dimethylthiophen-3-yl)pyrrolidine.
| Compound Name | 2-(4-bromo-2,5-dimethylthiophen-3-yl)pyrrolidine |
|---|---|
| PubChem CID | 84710165 |
| Molecular Formula | C10H14BrNS |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 2-(4-bromo-2,5-dimethylthiophen-3-yl)pyrrolidine |
| SMILES | Cc1sc(C)c(C2CCCN2)c1Br |
| InChI | InChI=1S/C10H14BrNS/c1-6-9(8-4-3-5-12-8)10(11)7(2)13-6/h8,12H,3-5H2,1-2H3 |
| InChIKey | SEZNFNDGLRQHOJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |