C12H18N2O — CID 84734110
(1-propan-2-ylpyrrol-2-yl)-pyrrolidin-2-ylmethanone (PubChem CID 84734110) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (1-propan-2-ylpyrrol-2-yl)-pyrrolidin-2-ylmethanone.
| Compound Name | (1-propan-2-ylpyrrol-2-yl)-pyrrolidin-2-ylmethanone |
|---|---|
| PubChem CID | 84734110 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (1-propan-2-ylpyrrol-2-yl)-pyrrolidin-2-ylmethanone |
| SMILES | CC(C)n1cccc1C(=O)C1CCCN1 |
| InChI | InChI=1S/C12H18N2O/c1-9(2)14-8-4-6-11(14)12(15)10-5-3-7-13-10/h4,6,8-10,13H,3,5,7H2,1-2H3 |
| InChIKey | LESUCPUNFXPNOC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |