C10H17N3O2 — CID 84734570
4-(3-aminopropanoyl)-5-tert-butyl-1,3-dihydroimidazol-2-one (PubChem CID 84734570) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-(3-aminopropanoyl)-5-tert-butyl-1,3-dihydroimidazol-2-one.
| Compound Name | 4-(3-aminopropanoyl)-5-tert-butyl-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 84734570 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 4-(3-aminopropanoyl)-5-tert-butyl-1,3-dihydroimidazol-2-one |
| SMILES | CC(C)(C)c1[nH]c(=O)[nH]c1C(=O)CCN |
| InChI | InChI=1S/C10H17N3O2/c1-10(2,3)8-7(6(14)4-5-11)12-9(15)13-8/h4-5,11H2,1-3H3,(H2,12,13,15) |
| InChIKey | NBPKOSFYWZAJJI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |