C14H19NO — CID 84735051
1-cyclopentyl-3,4-dihydro-2H-quinolin-5-ol (PubChem CID 84735051) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-cyclopentyl-3,4-dihydro-2H-quinolin-5-ol.
| Compound Name | 1-cyclopentyl-3,4-dihydro-2H-quinolin-5-ol |
|---|---|
| PubChem CID | 84735051 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-cyclopentyl-3,4-dihydro-2H-quinolin-5-ol |
| SMILES | Oc1cccc2c1CCCN2C1CCCC1 |
| InChI | InChI=1S/C14H19NO/c16-14-9-3-8-13-12(14)7-4-10-15(13)11-5-1-2-6-11/h3,8-9,11,16H,1-2,4-7,10H2 |
| InChIKey | AWONLAOXADINGK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |