C9H9BrF3NO — CID 84739096
3-amino-2-(3-bromophenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 84739096) has the molecular formula C9H9BrF3NO and a molecular weight of 284.07 g/mol. Its IUPAC name is 3-amino-2-(3-bromophenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-amino-2-(3-bromophenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 84739096 |
| Molecular Formula | C9H9BrF3NO |
| Molecular Weight | 284.07 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 3-amino-2-(3-bromophenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | NCC(O)(c1cccc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C9H9BrF3NO/c10-7-3-1-2-6(4-7)8(15,5-14)9(11,12)13/h1-4,15H,5,14H2 |
| InChIKey | JIVGENADPYCTIR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.07 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |